Hexabromobenzene
ALDRICH/107131 - 98%
CAS Number: 87-82-1
Empirical Formula (Hill Notation): C6Br6
Molecular Weight: 551.49
EC Number: 201-773-9
MDL Number: MFCD00000058
Linear Formula: C6Br6
Product Type: Chemical
| assay | 98% |
| form | solid |
| functional group | bromo |
| InChI | 1S/C6Br6/c7-1-2(8)4(10)6( |
| InChI key | CAYGQBVSOZLICD-UHFFFAOYSA |
| mp | >300 °C (lit.) |
| Quality Level | 100  |
| SMILES string | Brc1c(Br)c(Br)c(Br)c(Br)c |
| solubility | chloroform: soluble 10 mg/mL |
| Application: | The porphyrinogenic potential of hexabromobenzene (HBB) with hexachlorobenzene was studied in the liver of primiparous rats. |
| General description: | Hexabromobenzene is used as fire retardant in plastics, paper and electric manufactured goods. It undergoes protodebromination when treated with sodium methoxide in methanol and ethyl methyl ketone to give a mixture of tetrabromobenzenes. |
| Packaging: | 25 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 - H315 - H319 - H335 - H413 |
| Precautionary statements | P273 - P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312 - P305 + P351 + P338 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22-36/37/38 |
| Safety Statements | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | >300 °C (lit.) |
| UNSPSC | 12352100 |