cis-Decahydronaphthalene
ALDRICH/110469 - 99%
Synonym: cis-Decalin™
CAS Number: 493-01-6
Empirical Formula (Hill Notation): C10H18
Molecular Weight: 138.25
EC Number: 207-770-9
MDL Number: MFCD00064189
Linear Formula: C10H18
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 110469-50G.
| assay | 99% |
| autoignition temp. | 482 °F |
| bp | 193 °C (lit.) |
| density | 0.897 g/mL at 25 °C (lit.) |
| expl. lim. | 0.7-4.9 %, 100 °F |
| InChI | 1S/C10H18/c1-2-6-10-8-4-3 |
| InChI key | NNBZCPXTIHJBJL-AOOOYVTPSA |
| mp | −43 °C (lit.) |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | [H][C@]12CCCC[C@@]1([H])C |
| vapor density | 4.76 (vs air) |
| vapor pressure | 42 mmHg ( 92 °C) |
| Application: | cis-Decahydronaphthalene is used as a quantitation standard in the determination of sesquiterpanes. |
| Legal Information: | Decalin is a trademark of Sigma-Aldrich Co. LLC |
| Packaging: | 10, 50 g in glass bottle |
| Symbol |      GHS02,GHS05,GHS06,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H226 - H304 - H314 - H331 - H411 |
| Precautionary statements | P210 - P280 - P301 + P310 + P331 - P301 + P330 + P331 - P303 + P361 + P353 - P305 + P351 + P338 |
| Hazard Codes | C,N |
| Risk Statements | 20-34-51/53-65 |
| Safety Statements | 26-36/37/39-45-61-62 |
| RIDADR | UN1147 - class 3 - PG 3 - Decahydronaphthalene |
| WGK Germany | WGK 3 |
| Flash Point(F) | 136.4 °F - closed cup |
| Flash Point(C) | 58 °C - closed cup |
| Purity | 99% |
| bp | 193 °C (lit.) |
| mp | −43 °C (lit.) |
| Density | 0.897 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |