1,4-Di-tert-butylbenzene
ALDRICH/113352 - 98%
CAS Number: 1012-72-2
Empirical Formula (Hill Notation): C14H22
Molecular Weight: 190.32
EC Number: 213-790-9
MDL Number: MFCD00008836
Linear Formula: C6H4[C(CH3)3]2
Product Type: Chemical
| assay | 98% |
| bp | 236 °C (lit.) |
| form | solid |
| InChI | 1S/C14H22/c1-13(2,3)11-7- |
| InChI key | OOWNNCMFKFBNOF-UHFFFAOYSA |
| mp | 76-78 °C (lit.) |
| Quality Level | 100  |
| SMILES string | CC(C)(C)c1ccc(cc1)C(C)(C) |
| Application: | 1,4-di-tert-butylbenzene (DTBB) is crystallized from several organic solvents to study the effect of solvents and crystallization conditions on its habit. |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS09 |
| Signal word | Warning |
| Hazard statements | H410 |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 22-24/25-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| bp | 236 °C (lit.) |
| mp | 76-78 °C (lit.) |
| UNSPSC | 12352100 |