2-Methyl-3-nitroanisole
ALDRICH/115428 - 99%
CAS Number: 4837-88-1
Empirical Formula (Hill Notation): C8H9NO3
Molecular Weight: 167.16
EC Number: 225-424-5
MDL Number: MFCD00007159
Linear Formula: CH3C6H3(NO2)OCH3
Product Type: Chemical
| assay | 99% |
| form | solid |
| InChI | 1S/C8H9NO3/c1-6-7(9(10)11 |
| InChI key | HQCZLEAGIOIIMC-UHFFFAOYSA |
| mp | 54-56 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | COc1cccc(c1C)[N+]([O-])=O |
| Application: | 2-Methyl-3-nitroanisole may be used in chemical synthesis studies. |
| Packaging: | 1, 10 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 54-56 °C (lit.) |
| UNSPSC | 12352100 |


