5,7-Dimethoxycoumarin
ALDRICH/116238 - 98%
Synonym: Citropten; Limettin
CAS Number: 487-06-9
Empirical Formula (Hill Notation): C11H10O4
Molecular Weight: 206.19
EC Number: 207-646-4
MDL Number: MFCD00006870
Linear Formula: C11H10O4
Product Type: Chemical
| assay | 98% |
| form | solid |
| functional group | ester |
| InChI | 1S/C11H10O4/c1-13-7-5-9(1 |
| InChI key | NXJCRELRQHZBQA-UHFFFAOYSA |
| mp | 146-149 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | COc1cc(OC)c2C=CC(=O)Oc2c1 |
| Biochem/physiol Actions: | 5,7-Dimethoxycoumarin induces the processes of differentiation and melanogenesis in murine (B16) and human (A375). |
| General description: | 5,7-dimethoxycoumarin is isolated and identified from leaves and fruits of Pelea anisata H. Mann, a plant whose fruit are used in the construction of mohikana leis. It induces frameshift mutagenesis in bacteria. It also causes lethal photosensitization and the formation of sister chromatid exchanges in Chinese hamster cells. |
| Packaging: | 1 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P264 - P270 - P301 + P312 - P501 |
| Hazard Codes | Xi |
| Risk Statements | 43 |
| Safety Statements | 36/37 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 146-149 °C (lit.) |
| UNSPSC | 12352100 |


