(R)-(−)-Carvone
ALDRICH/124931 - 98%
Synonym: (−)-Carvone; (R)
CAS Number: 6485-40-1
Empirical Formula (Hill Notation): C10H14O
Molecular Weight: 150.22
EC Number: 229-352-5
MDL Number: MFCD00001578
Linear Formula: C10H14O
Product Type: Chemical
| assay | 98% |
| bp | 227-230 °C (lit.) |
| density | 0.959 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C10H14O/c1-7(2)9-5-4-8 |
| InChI key | ULDHMXUKGWMISQ-SECBINFHSA |
| optical activity | [α]20/D −61°, neat |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CC(=C)[C@@H]1CC=C(C)C(=O) |
| vapor density | 5.2 (vs air) |
| vapor pressure | 0.4 mmHg ( 20 °C) |
| Application: | (R)-(−)-Carvone may be employed as starting reagent for the synthesis of enantiopure (R)-(+)-3-methyl-6-isoprope |
| Application: | Chiral starting material. |
| General description: | (R)-(−)-Carvone is a monoterpenoid. Its ozonolysis in the gaseous phase has been proposed. Aldehydes (formaldehyde) and biradicals were obtained as the major products. It participates in the diastereoselective synthesis of homochiral octalones. |
| Packaging: | 100, 500 mL in poly bottle |
| Packaging: | 5 mL in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H317 |
| Precautionary statements | P261 - P264 - P270 - P280 - P301 + P312 - P302 + P352 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | 192.2 °F - closed cup |
| Flash Point(C) | 89 °C - closed cup |
| Purity | 98% |
| bp | 227-230 °C (lit.) |
| Density | 0.959 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352115 |