Bis(5-chloro-2-hydroxyphenyl)methane
ALDRICH/133221 - 95%
Synonym: Dichlorophen; Dichlorophene
CAS Number: 97-23-4
Empirical Formula (Hill Notation): C13H10Cl2O2
Molecular Weight: 269.12
EC Number: 202-567-1
MDL Number: MFCD00002322
Linear Formula: CH2[C6H3(Cl)OH]2
Product Type: Chemical
| assay | 95% |
| form | powder |
| functional group | chloro |
| InChI | 1S/C13H10Cl2O2/c14-10-1-3 |
| InChI key | MDNWOSOZYLHTCG-UHFFFAOYSA |
| mp | 168-172 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | Oc1ccc(Cl)cc1Cc2cc(Cl)ccc |
| solubility | 95% ethanol: soluble 1g/g |
| methanol: soluble | |
| petroleum ether: soluble | |
| toluene: very slightly soluble | |
| water: insoluble |
| Application: | Bis(5-chloro-2-hydroxyphe |
| Disclaimer: | The product is not intended for use as a biocide under global biocide regulations, including but not limited to US EPA′s Federal Insecticide Fungicide and Rodenticide Act, European Biocidal Products Regulation, Canada’s Pest Management Regulatory Agency, Turkey’s Biocidal Products Regulation, Korea’s Consumer Chemical Products and Biocide Safety Management Act (K-BPR) and others. |
| General description: | Bis(5-chloro-2-hydroxyphe |
| Packaging: | 50 g in poly bottle |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H302 - H319 - H410 |
| Precautionary statements | P273 - P301 + P312 + P330 - P305 + P351 + P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-50/53 |
| Safety Statements | 26-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| mp | 168-172 °C (lit.) |
| UNSPSC | 12352100 |



