6-Nitropiperonal
ALDRICH/137650 - 97%
CAS Number: 712-97-0
Empirical Formula (Hill Notation): C8H5NO5
Molecular Weight: 195.13
EC Number: 211-926-1
MDL Number: MFCD00005829
Linear Formula: C8H5NO5
Product Type: Chemical
| assay | 97% |
| functional group | aldehyde |
| nitro | |
| InChI | 1S/C8H5NO5/c10-3-5-1-7-8( |
| InChI key | NRZWECORTTWSEF-UHFFFAOYSA |
| mp | 93-94 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | [H]C(=O)c1cc2OCOc2cc1[N+] |
| Application: | 6-Nitropiperonal was used to study the mechanism of aromatic nucleophilic substitution reaction of [18F]Fluoride ion. It was used in the synthesis of 6-[18F]fluoro-L-dopa. |
| Packaging: | 25 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 93-94 °C (lit.) |
| UNSPSC | 12352100 |

