1-Pyrenecarboxaldehyde
ALDRICH/144037 - 99%
Synonym: 1-Formylpyrene; 1-Pyrenealdehyde; 1-Pyrenecarbaldehyde; 3-Pyrenylaldehyde
CAS Number: 3029-19-4
Empirical Formula (Hill Notation): C17H10O
Molecular Weight: 230.26
EC Number: 221-196-6
MDL Number: MFCD00004139
Linear Formula: C17H10O
Product Type: Chemical
| assay | 99% |
| form | liquid |
| InChI | 1S/C17H10O/c18-10-14-7-6- |
| InChI key | RCYFOPUXRMOLQM-UHFFFAOYSA |
| mp | 123-126 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | [H]C(=O)c1ccc2ccc3cccc4cc |
| Features and Benefits: | Exhibits reversible tuning properties with temperature and the properties depend upon the solvent environment. |
| General description: | 1-Pyrenecarboxaldehyde (PCA) is a bifunctional molecule with pyrene moiety and one aldehyde group. The pyrene moiety interacts with the side walls of carbon nanotubes(CNT) through π-π stacking which leads to the uniform immobilization of PCA on the CNT surface. Therefore, it is widely used for the surface functionalization of CNTs. It can also be used to fabricate fluorescent chemosensors. |
| Packaging: | 10, 50 g in poly bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 123-126 °C (lit.) |
| UNSPSC | 12352103 |


