Synonym: (Ethene-1,1-diyldisulfonyl)dibenzene; 1,1-Bis(benzenesulfonyl)ethylene; 1,1-Bis(phenylsulfonyl)ethene; 1,1′-[Ethenylidenebis(sulfonyl)]bis[benzene]
CAS Number: 39082-53-6
Empirical Formula (Hill Notation): C14H12O4S2
Molecular Weight: 308.37
MDL Number: MFCD00043149
Linear Formula: C14H12O4S2
Product Type: Chemical
| assay |
≥98.0% (CH) |
| form |
powder |
| functional group |
sulfone |
| InChI |
1S/C14H12O4S2/c1-12(19(15,16)13-8-4-2-5-9-13)20(17,18)14-10-6-3-7-11-14/h2-11H,1H2 |
| InChI key |
KABQEPJVQFXVIN-UHFFFAOYSA-N |
| mp |
124-126 °C |
| Quality Level |
100  |
| SMILES string |
C=C(S(=O)(=O)c1ccccc1)S(=O)(=O)c2ccccc2 |
| Application: |
1,1-Bis(phenylsulfonyl)ethylene was used in the preparation of α,α-disubstituted alpha-amino acid derivatives. |
| Other Notes: |
A synthetic equivalent of the ethylene 1,2-dipole; Dienophile for Diels-Alder reactions, review; A useful synthon for neutral homologation of ketones. |
| Packaging: |
1 g in glass bottle |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
≥98.0% (CH) |
| mp |
124-126 °C |
| UNSPSC |
12352100 |
