Synonym: 2,6-Bis(1,1-dimethylethyl)-2,5-cyclohexadiene-1,4-dione; 2,6-Bis[1,1-dimethyl ethyl]quinone; 2,6-Di-tert-butyl-2,5-cyclohexadiene-1,4-dione; 2,6-Di-tert-butylbenzoquinone; 3,5-Di-tert-butylquinone
CAS Number: 719-22-2
Empirical Formula (Hill Notation): C14H20O2
Molecular Weight: 220.31
EC Number: 211-946-0
MDL Number: MFCD00001601
Linear Formula: [(CH3)3C]2C6H2(=O)2
Product Type: Chemical
| assay |
98% |
| form |
solid |
| functional group |
ketone |
| InChI |
1S/C14H20O2/c1-13(2,3)10-7-9(15)8-11(12(10)16)14(4,5)6/h7-8H,1-6H3 |
| InChI key |
RDQSIADLBQFVMY-UHFFFAOYSA-N |
| mp |
65-67 °C (lit.) |
| Quality Level |
100  |
| SMILES string |
CC(C)(C)C1=CC(=O)C=C(C1=O)C(C)(C)C |
| Application: |
2,6-Di-tert-butyl-1,4-benzoquinone was used as an antioxidant to study the elimination rate of micro pollutant from storm and waste water. It was also used as a metabolite of butylated hydroxytoluene. |
| Packaging: |
1, 5 g in glass bottle |
| Purity |
98% |
| mp |
65-67 °C (lit.) |
| UNSPSC |
12352100 |