Boc-Lys-OH
ALDRICH/15456 - ≥99.0% (NT)
Synonym: Nα-(tert-Butoxycarbonyl)-L-lysine; Nα-Boc-L-lysine
CAS Number: 13734-28-6
Empirical Formula (Hill Notation): C11H22N2O4
Molecular Weight: 246.30
EC Number: 237-303-4
MDL Number: MFCD00038203
Linear Formula: NH2(CH2)4CH(COOH)NHCOOC(CH3)3
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | ≥99.0% (NT) |
| form | solid |
| InChI | 1S/C11H22N2O4/c1-11(2,3)1 |
| InChI key | DQUHYEDEGRNAFO-QMMMGPOBSA |
| mp | ~205 °C (dec.) (lit.) |
| optical activity | [α]20/D +4.6±0.5°, c = 2% in H2O |
| Quality Level | 200  |
| reaction suitability | reaction type: Boc solid-phase peptide synthesis |
| SMILES string | CC(C)(C)OC(=O)N[C@@H](CCC |
| Application: | Boc-Lys-OH is used as a building block to form peptides that have bioorthogonal reactive groups via boc protected solid phase synthesis. |
| General description: | Boc-Lys-OH also known as Nα-Boc-L-lysine, is an amino acid derivative of lysine which is used in solid phase peptide synthesis. |
| Packaging: | 5, 25 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥99.0% (NT) |
| mp | ~205 °C (dec.) (lit.) |
| UNSPSC | 12352209 |