N-Boc-p-phenylenediamine
ALDRICH/15485 - ≥97.0% (NT)
Synonym: 4-(tert-
CAS Number: 71026-66-9
Empirical Formula (Hill Notation): C11H16N2O2
Molecular Weight: 208.26
EC Number: 275-132-7
MDL Number: MFCD00043022
Linear Formula: (CH3)3COCONHC6H4NH2
Product Type: Chemical
| assay | ≥97.0% (NT) |
| form | powder |
| functional group | amine |
| Boc | |
| InChI | 1S/C11H16N2O2/c1-11(2,3)1 |
| InChI key | WIVYTYZCVWHWSH-UHFFFAOYSA |
| Quality Level | 200  |
| reaction suitability | reagent type: cross-linking reagent |
| SMILES string | NC1=CC=C(NC(OC(C)(C)C)=O) |
| Application: | N-Boc-p-phenylenediamine can be used as: • A reactant to prepare perylene monoimide-based dyes for dye-sensitized solar cell applications. • A starting material to synthesize covalent organic frameworks, which are used as proton exchange membranes for hydrogen fuel cell applications. • A reactant in the synthesis of bestatin derived hydroxamic acids as potent pan-HDAC inhibitors. |
| Other Notes: | Mono-N-acylated diamine, precursor of different Para-substituted anilines (e.g., 4-azido aniline); Synthesis of photoactivable derivative of ouabaine. |
| Packaging: | 5, 25 g in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H317 |
| Precautionary statements | P280 - P301 + P312 + P330 - P302 + P352 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-43-50/53 |
| Safety Statements | 36/37-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97.0% (NT) |
| UNSPSC | 12352116 |