3-Nitrophthalic anhydride
ALDRICH/156884 - 98%
Synonym: 3-Nitrophthalic acid anhydride; 4-
CAS Number: 641-70-3
Empirical Formula (Hill Notation): C8H3NO5
Molecular Weight: 193.11
EC Number: 211-373-6
MDL Number: MFCD00005921
Linear Formula: C8H3NO5
Product Type: Chemical
| assay | 98% |
| form | solid |
| InChI | 1S/C8H3NO5/c10-7-4-2-1-3- |
| InChI key | ROFZMKDROVBLNY-UHFFFAOYSA |
| mp | 163-165 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | [O-][N+](=O)c1cccc2C(=O)O |
| Application: | Reactions with aminoquinazolinones yield phthalimidoquinazolinones |
| Packaging: | 5, 25 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 163-165 °C (lit.) |
| UNSPSC | 12162002 |


