4,4′-Dimethoxybenzil
ALDRICH/159611 - 98%
Synonym: p-Anisil; Di-p-anisoyl
CAS Number: 1226-42-2
Empirical Formula (Hill Notation): C16H14O4
Molecular Weight: 270.28
EC Number: 214-960-5
MDL Number: MFCD00008405
Linear Formula: CH3OC6H4COCOC6H4OCH3
Product Type: Chemical
| assay | 98% |
| form | solid |
| functional group | ketone |
| InChI | 1S/C16H14O4/c1-19-13-7-3- |
| InChI key | YNANGXWUZWWFKX-UHFFFAOYSA |
| mp | 132-134 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | COc1ccc(cc1)C(=O)C(=O)c2c |
| General description: | Mesomorphic properties of a substituted bis(dithiolene)nickel complex derived from 4,4′-dimethoxybenzil has been reported. Diffuse scattering in 4,4′-dimethoxybenzil has been studied via Monte Carlo computer-simulation model. |
| Packaging: | 5 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| Purity | 98% |
| mp | 132-134 °C (lit.) |
| UNSPSC | 12352100 |

