Fmoc chloride
ALDRICH/160512 - 97%
Synonym: 9-
CAS Number: 28920-43-6
Empirical Formula (Hill Notation): C15H11ClO2
Molecular Weight: 258.70
EC Number: 249-313-6
MDL Number: MFCD00001138
Linear Formula: C15H11ClO2
Product Type: Chemical
| application(s) | peptide synthesis |
| assay | 97% |
| form | solid |
| functional group | chloro |
| Fmoc | |
| InChI | 1S/C15H11ClO2/c16-15(17)1 |
| InChI key | IRXSLJNXXZKURP-UHFFFAOYSA |
| mp | 62-64 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | ClC(=O)OCC1c2ccccc2-c3ccc |
| storage temp. | 2-8°C |
| Application: | Amino acid derivatizing agent for HPLC analysis. N-protecting reagent for peptide and oligonucleotide syntheses. |
| Application: | Reagent for amino group protection recently used in the synthesis of a bicyclic proline analog. |
| Application: | Reagent for derivatizing amino acids for HPLC amino acid analysis and for preparing N-Fmoc amino acids for solid-phase peptide synthesis. |
| Packaging: | 1, 5, 25 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 - P363 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Supplemental Hazard Statements | EUH029 |
| Purity | 97% |
| mp | 62-64 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352108 |


