Methyl 4-nitrobenzenesulfonate
ALDRICH/160954 - 99%
Synonym: Methyl nosylate; Methyl p-
CAS Number: 6214-20-6
Empirical Formula (Hill Notation): C7H7NO5S
Molecular Weight: 217.20
EC Number: 228-282-2
MDL Number: MFCD00007344
Linear Formula: O2NC6H4SO3CH3
Product Type: Chemical
| assay | 99% |
| form | solid |
| functional group | nitro |
| sulfonic acid | |
| InChI | 1S/C7H7NO5S/c1-13-14(11,1 |
| InChI key | RMNJNEUWTBBZPT-UHFFFAOYSA |
| mp | 89-92 °C (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | COS(=O)(=O)c1ccc(cc1)[N+] |
| solubility | acetone: soluble 5%, clear, faintly yellow to greenish-yellow |
| General description: | Reaction between methyl 4-nitrobenzenesulfonate and bromide ions has been studied in mixed single-chain-gemini micellar solutions. Kinetics of SN2 reactions of methyl 4-nitrobenzenesulfonate with ammonia, primary amines, secondary amines, tertiary amines and anionic nucleophiles has been studied. |
| Packaging: | 1, 10 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 99% |
| mp | 89-92 °C (lit.) |
| UNSPSC | 12352100 |


