Methyl 4-tert-butylbenzoate
ALDRICH/167533 - 99%
CAS Number: 26537-19-9
Empirical Formula (Hill Notation): C12H16O2
Molecular Weight: 192.25
EC Number: 247-768-5
MDL Number: MFCD00008835
Linear Formula: (CH3)3CC6H4CO2CH3
Product Type: Chemical
assay | 99% |
bp | 122-124 °C/9 mmHg (lit.) |
density | 0.995 g/mL at 25 °C (lit.) |
form | liquid |
InChI | 1S/C12H16O2/c1-12(2,3)10- |
InChI key | UPIJOAFHOIWPLT-UHFFFAOYSA |
Quality Level | 100 ![]() |
refractive index | n |
SMILES string | COC(=O)c1ccc(cc1)C(C)(C)C |
Application: | Methyl 4-tert-butylbenzoate was used in the synthesis of tris(4-tert-butylphenyl)methyl chloride. |
General description: | Methyl 4-tert-butylbenzoate undergoes Claisen condensation reaction with 4-methoxyacetophenone to give avobenzone, an ingredient of sunscreen products. |
Packaging: | 25 g in glass bottle |
Symbol | ![]() |
Signal word | Warning |
Hazard statements | H302 + H312 + H332 |
Precautionary statements | P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312 |
RIDADR | NONH for all modes of transport |
WGK Germany | WGK 3 |
Flash Point(F) | 270.5 °F |
Flash Point(C) | 132.5 °C |
Purity | 99% |
bp | 122-124 °C/9 mmHg (lit.) |
Density | 0.995 g/mL at 25 °C (lit.) |
Refractive Index | n |
UNSPSC | 12352100 |