3-Nitrobenzonitrile
ALDRICH/167746 - 98%
CAS Number: 619-24-9
Empirical Formula (Hill Notation): C7H4N2O2
Molecular Weight: 148.12
EC Number: 210-587-7
MDL Number: MFCD00007194
Linear Formula: O2NC6H4CN
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 167746-25G
| assay | 98% |
| form | solid |
| InChI | 1S/C7H4N2O2/c8-5-6-2-1-3- |
| InChI key | RUSAWEHOGCWOPG-UHFFFAOYSA |
| mp | 114-117 °C (lit.) |
| Quality Level | 100  |
| SMILES string | [O-][N+](=O)c1cccc(c1)C#N |
| Application: | 3-Nitrobenzonitrile was employed as matrix for matrix assisted ionization vacuum method for mass spectrometery. |
| Packaging: | 25 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 |
| Precautionary statements | P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 22-24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 114-117 °C (lit.) |
| UNSPSC | 12352100 |