Triethoxyphenylsilane
ALDRICH/175609 - 98%
Synonym: Phenyltriethoxysilane
CAS Number: 780-69-8
Empirical Formula (Hill Notation): C12H20O3Si
Molecular Weight: 240.37
EC Number: 212-305-8
MDL Number: MFCD00009065
Linear Formula: C6H5Si(OC2H5)3
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 175609-1KG.
| assay | 98% |
| bp | 112-113 °C/10 mmHg (lit.) |
| density | 0.996 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C12H20O3Si/c1-4-13-16( |
| InChI key | JCVQKRGIASEUKR-UHFFFAOYSA |
| Quality Level | 200  |
| refractive index | n |
| SMILES string | CCO[Si](OCC)(OCC)c1ccccc1 |
| vapor density | >1 (vs air) |
| Application: | A silicon-based nucleophile shown to be reactive in Pd-catalyzed cross-coupling reactions. |
| Packaging: | 1 kg in glass bottle |
| Packaging: | 5, 250 g in glass bottle |
| Symbol |  GHS08 |
| Signal word | Warning |
| Hazard statements | H373 - H412 |
| Precautionary statements | P260 - P273 - P314 - P501 |
| Risk Statements | 10 |
| RIDADR | UN 1993C 3 / PGIII |
| WGK Germany | WGK 3 |
| Purity | 98% |
| bp | 112-113 °C/10 mmHg (lit.) |
| Density | 0.996 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352103 |