Synonym: (+)-Limonene epoxide; (+)-p-Mentha-1,8-diene 1,2-epoxide; (4R)-1,2-Epoxy-p-menth-8-ene; (4R)-4-Isopropenyl-1-methyl-1-cyclohexene 1,2-epoxide
CAS Number: 203719-54-4
Empirical Formula (Hill Notation): C10H16O
Molecular Weight: 152.23
MDL Number: MFCD00074770
Linear Formula: C10H16O
Product Type: Chemical
| assay |
≥97.0% (sum of isomers, GC) |
| density |
0.930 g/mL at 20 °C (lit.) |
| form |
liquid |
| functional group |
ether |
| InChI |
1S/C10H16O/c1-7(2)8-4-5-10(3)9(6-8)11-10/h8-9H,1,4-6H2,2-3H3/t8-,9?,10?/m1/s1 |
| InChI key |
CCEFMUBVSUDRLG-XNWIYYODSA-N |
| Quality Level |
100  |
| refractive index |
n20/D 1.467 |
| SMILES string |
CC(=C)[C@@H]1CCC2(C)OC2C1 |
| storage temp. |
2-8°C |
| General description: |
(+)-Limonene 1,2-epoxide, a monoterpene that can be prepared from (+)-limonene. It shows potent antinociceptive and antitumoral activity and is mainly used as a building block in synthesis of pharmaceutical products, perfumes, cosmetics and food additives. |
| Packaging: |
100 mL in glass bottle |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
149.0 °F - closed cup |
| Flash Point(C) |
65 °C - closed cup |
| Purity |
≥97.0% (sum of isomers, GC) |
| Density |
0.930 g/mL at 20 °C (lit.) |
| Refractive Index |
n20/D 1.467 |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352005 |