5-Chloro-2-nitrobenzyl alcohol
ALDRICH/187402 - 98%
CAS Number: 73033-58-6
Empirical Formula (Hill Notation): C7H6ClNO3
Molecular Weight: 187.58
EC Number: 277-241-5
MDL Number: MFCD00007291
Linear Formula: ClC6H3(NO2)CH2OH
Product Type: Chemical
This picture is provided solely for illustration purposes, it may have been created or edited with AI. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 187402-10G
ATR-IR Spectra for 5-Chloro-2-nitrobenzyl alcohol.
| assay | 98% |
| form | liquid |
| functional group | chloro |
| hydroxyl | |
| nitro | |
| InChI | 1S/C7H6ClNO3/c8-6-1-2-7(9 |
| InChI key | ULYZTHQGJXPEFT-UHFFFAOYSA |
| mp | 78-79 °C (lit.) |
| Quality Level | 100  |
| SMILES string | OCc1cc(Cl)ccc1[N+]([O-])= |
| Application: | 5-Chloro-2-nitrobenzyl alcohol was used in the synthesis of carbamates. |
| Packaging: | 10 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P261 - P264 - P271 - P280 - P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38-51 |
| Safety Statements | 26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 78-79 °C (lit.) |
| UNSPSC | 12352100 |