1,3-Dimethyladamantane
ALDRICH/187836 - ≥99%
Synonym: 1,3-
CAS Number: 702-79-4
Empirical Formula (Hill Notation): C12H20
Molecular Weight: 164.29
EC Number: 211-870-8
MDL Number: MFCD00074755
Linear Formula: C12H20
Product Type: Chemical
ATR-IR Spectra for 1,3-Dimethyltricyclo[3.3.1.13,7]decane.
| assay | ≥99% |
| density | 0.886 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C12H20/c1-11-4-9-3-10( |
| InChI key | CWNOIUTVJRWADX-BKUVIOGVSA |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | C[C@]12C[C@@H]3C[C@H](C1) |
| Application: | 1,3-Dimethyladamantane was used in the synthesis of 1,3-dibromo-5,7-dimethyla |
| General description: | 1,3-Dimethyladamantane undergoes C-H insertion reaction with phenylchlorocarbene. It reacts with with molecular oxygen in the presence of N-hydroxyphthalimide combined with cobalt salts to yield 3,5-dimethyladamantan-1-o |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS02 |
| Signal word | Warning |
| Hazard statements | H226 |
| Risk Statements | 10 |
| RIDADR | UN 3295C 3 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 127.4 °F - closed cup |
| Flash Point(C) | 53 °C - closed cup |
| Purity | ≥99% |
| Density | 0.886 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352100 |