3-Methyl-2-nitrobenzyl alcohol
ALDRICH/188263 - 98%
CAS Number: 80866-76-8
Empirical Formula (Hill Notation): C8H9NO3
Molecular Weight: 167.16
EC Number: 279-579-9
MDL Number: MFCD00007182
Linear Formula: CH3C6H3(NO2)CH2OH
Product Type: Chemical
| assay | 98% |
| form | powder |
| functional group | hydroxyl |
| nitro | |
| InChI | 1S/C8H9NO3/c1-6-3-2-4-7(5 |
| InChI key | NELPTBUSFQMYOB-UHFFFAOYSA |
| mp | 48-50 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | Cc1cccc(CO)c1[N+]([O-])=O |
| Application: | 3-Methyl-2-nitrobenzyl alcohol was used as starting reagent in the synthesis of 7-formyl-indole. |
| General description: | 3-Methyl-2-nitrobenzyl alcohol undergoes condensation with N,N-dimethylformamide dimethyl acetal followed by catalytic hydrogenation to yield 7-hydroxymethyl-indole. |
| Packaging: | 5, 25 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 235.4 °F - closed cup |
| Flash Point(C) | 113 °C - closed cup |
| Purity | 98% |
| mp | 48-50 °C (lit.) |
| UNSPSC | 12352100 |

