4-Oxo-4H-1-benzopyran-2-carboxylic acid
ALDRICH/189782 - 97%
Synonym: 4-Oxo-4H-
CAS Number: 4940-39-0
Empirical Formula (Hill Notation): C10H6O4
Molecular Weight: 190.15
EC Number: 225-583-0
MDL Number: MFCD00006838
Linear Formula: C10H6O4
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 189782-5G
| assay | 97% |
| form | powder |
| functional group | carboxylic acid |
| ketone | |
| InChI | 1S/C10H6O4/c11-7-5-9(10(1 |
| InChI key | RVMGXWBCQGAWBR-UHFFFAOYSA |
| mp | 260 °C (dec.) (lit.) |
| Quality Level | 200  |
| SMILES string | OC(=O)C1=CC(=O)c2ccccc2O1 |
| solubility | alcohol: soluble |
| ammonium hydroxide: soluble | |
| water: very slightly soluble |
| General description: | Nasal absorption of 4-oxo-4H-1-benzopyran-2-carboxylic acid has been investigated in the male Wistar rat. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 260 °C (dec.) (lit.) |
| UNSPSC | 12352100 |