Sodium trichloroacetate
ALDRICH/190780 - 97%
Synonym: NaTCA; TCA sodium salt; Trichloroacetic acid sodium salt
CAS Number: 650-51-1
Empirical Formula (Hill Notation): C2Cl3NaO2
Molecular Weight: 185.37
EC Number: 211-479-2
MDL Number: MFCD00064198
Linear Formula: CCl3CO2Na
Product Type: Chemical
| assay | 97% |
| functional group | chloro |
| InChI | 1S/C2HCl3O2.Na/c3-2(4,5)1 |
| InChI key | SAQSTQBVENFSKT-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | [Na+].[O-]C(=O)C(Cl)(Cl)C |
| Application: | Sodium trichloroacetate with trichloroacetic acid (TCA) undergoes rapid decarboxylation in dimethylformamide (DMF) in the presence of aldehydes to form nucleophilic trichloromethyl anion, which then adds to the aldehydes to form trichloromethyl carbinols. It can also undergo thermal decarboxylation in aprotonic solvents in the presence of olefins to generate dichlorocarbene as an intermediate. |
| Packaging: | 100 g in poly bottle |
| Packaging: | 5 g in glass bottle |
| Symbol | ![]() GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H335 - H410 |
| Precautionary statements | P273 |
| Hazard Codes | Xi,N |
| Risk Statements | 36/37-50/53 |
| Safety Statements | 26-46-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 2 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| UNSPSC | 12352302 |



