3-Nitrobenzyl chloride
ALDRICH/191167 - 97%
Synonym: α-Chloro-3-nitrotoluene
CAS Number: 619-23-8
Empirical Formula (Hill Notation): C7H6ClNO2
Molecular Weight: 171.58
EC Number: 210-586-1
MDL Number: MFCD00007272
Linear Formula: O2NC6H4CH2Cl
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 191167-50G
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 191167-10G
| assay | 97% |
| bp | 85-87 °C/5 mmHg (lit.) |
| form | solid |
| functional group | chloro |
| nitro | |
| InChI | 1S/C7H6ClNO2/c8-5-6-2-1-3 |
| InChI key | APGGSERFJKEWFG-UHFFFAOYSA |
| mp | 43-47 °C (lit.) |
| Quality Level | 100  |
| SMILES string | [O-][N+](=O)c1cccc(CCl)c1 |
| Application: | 3-Nitrobenzyl chloride was used in the synthesis of 8-chloropurine. |
| General description: | Influence of solvent on reduction mechanism of 3-nitrobenzyl chloride was investigated by cyclic voltammetry and controlled potential bulk electrolysis. |
| Packaging: | 10, 50 g in glass bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| Purity | 97% |
| bp | 85-87 °C/5 mmHg (lit.) |
| mp | 43-47 °C (lit.) |
| UNSPSC | 12352100 |