Hydroxypropyl cellulose
ALDRICH/191892 - average Mw ~370,000, powder, 20 mesh particle size (99% through)
Synonym: HPC
CAS Number: 9004-64-2
MDL Number: MFCD00132688
Product Type: Chemical
| autoignition temp. | 752 °F |
| density | 0.5 g/mL at 25 °C (lit.) |
| description | biological oxygen demand (BOD) 14,000 ppm |
| form | powder |
| impurities | <5 wt. % |
| InChI | 1S/C12H20N2/c1-5-12(13)11 |
| InChI key | RRHXDYJWVYFMKV-UHFFFAOYSA |
| interfacial tension mineral oil | 12.5 dyn/cm, 0.1 wt. % in H2O (vs. mineral oil) |
| mol wt | average Mw ~370,000 |
| particle size | 20 mesh (99% through) |
| pH | 5.0-8.5 |
| Quality Level | 100 ![]() |
| SMILES string | N(C)(C)c1cc(c(cc1)C(N)CC) |
| solubility | H2O: insoluble (above 45 °C) |
| polar organic solvents: soluble | |
| viscosity | 150-400 cP, 2 wt. % in H2O(25 °C, Brookfield, spindle #2) (60 rpm)(lit.) |
| Application: | Hydroxypropyl cellulose can be used to prepare composite nanospheres for drug delivery systems. Hydroxypropyl methacrylate/hydroxy cellulose graft copolymers can be used as matrices for controlled-release tablets. It can also be used as an electrolyte additive to prepare gel polymerelectrolytes for dye-sensitized solar cells. |
| General description: | Hydroxypropyl cellulose (HPC) is a nonionic derivativeof cellulose. It is a thermosensitive, biodegradable polymer with low criticalsolution temperature. |
| Packaging: | 5, 100, 250 g in poly bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 1 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Density | 0.5 g/mL at 25 °C (lit.) |
| UNSPSC | 12162002 |

