(−)-Carveol, mixture of isomers
ALDRICH/192384 - 97%
Synonym: p-Mentha-6,8-dien-2-ol
CAS Number: 99-48-9
Empirical Formula (Hill Notation): C10H16O
Molecular Weight: 152.23
EC Number: 202-757-4
MDL Number: MFCD00869995
Linear Formula: C10H16O
Product Type: Chemical
| assay | 97% |
| bp | 226-227 °C/751 mmHg (lit.) |
| density | 0.958 g/mL at 25 °C (lit.) |
| functional group | hydroxyl |
| InChI | 1S/C10H16O/c1-7(2)9-5-4-8 |
| InChI key | BAVONGHXFVOKBV-YHMJZVADSA |
| optical activity | [α]20/D −112°, c = 1 in chloroform |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CC(=C)[C@@H]1CC=C(C)C(O)C |
| Packaging: | 10 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 208.4 °F - closed cup |
| Flash Point(C) | 98 °C - closed cup |
| Purity | 97% |
| bp | 226-227 °C/751 mmHg (lit.) |
| Density | 0.958 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352002 |


