Hexacyclen trisulfate
ALDRICH/193933
Synonym: 1,4,7,10,13,16-
CAS Number: 56187-09-8
Empirical Formula (Hill Notation): C12H30N6 · 3H2SO4
Molecular Weight: 552.64
MDL Number: MFCD00013154
Linear Formula: C12H30N6 · 3H2SO4
Product Type: Chemical
| form | solid |
| InChI | 1S/C12H30N6.3H2O4S/c1-2-1 |
| InChI key | UXVDKNLOZWKLJC-UHFFFAOYSA |
| Quality Level | 100 ![]() |
| SMILES string | OS(O)(=O)=O.OS(O)(=O)=O.O |
| Application: | Ligand used in the preparation of transition metal complexes and in chromium-initiated radical copolymerization reactions. |
| Packaging: | 1 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P260 - P280 - P301 + P330 + P331 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| UNSPSC | 12352005 |


