4-Chlorophenyl phenyl sulfone
ALDRICH/194115 - ≥97%
CAS Number: 80-00-2
Empirical Formula (Hill Notation): C12H9ClO2S
Molecular Weight: 252.72
EC Number: 201-242-1
MDL Number: MFCD00007549
Linear Formula: ClC6H4SO2C6H5
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 194115-100G
| assay | ≥97% |
| InChI | 1S/C12H9ClO2S/c13-10-6-8- |
| InChI key | OFCFYWOKHPOXKF-UHFFFAOYSA |
| mp | 90-94 °C (lit.) |
| SMILES string | Clc1ccc(cc1)S(=O)(=O)c2cc |
| solubility | acetone: soluble 74.4 g/100ml at 20 °C(lit.) |
| benzene: soluble 44.4 g /100ml at 20 °C(lit.) | |
| dioxane: soluble 65.6 g/100ml at 20 °C(lit.) | |
| hexane: soluble 0.4 g/100ml at 20 °C(lit.) | |
| isopropanol: soluble 21 g/100ml at 20 °C(lit.) |
| Application: | 4-Chlorophenyl phenyl sulfone was employed in polyetherification reaction of 4,4′-dihalodiphenyl sulfones. |
| General description: | 4-Chlorophenyl phenyl sulfone is also referred to as sulphenone. It participates in palladium-catalyzed amidation reaction in the presence of low CO pressures and an iodide salt. |
| Packaging: | 100 g in glass bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 + H312 + H332 |
| Precautionary statements | P261 - P264 - P280 - P301 + P312 - P302 + P352 + P312 - P304 + P340 + P312 |
| Hazard Codes | Xn |
| Risk Statements | 20/21/22 |
| Safety Statements | 36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | ≥97% |
| mp | 90-94 °C (lit.) |
| UNSPSC | 12352100 |