4-Biphenylacetic acid
ALDRICH/196487 - 98%
CAS Number: 5728-52-9
Empirical Formula (Hill Notation): C14H12O2
Molecular Weight: 212.24
EC Number: 227-233-2
MDL Number: MFCD00004351
Linear Formula: C6H5C6H4CH2CO2H
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 196487-5G
| assay | 98% |
| InChI | 1S/C14H12O2/c15-14(16)10- |
| InChI key | QRZAKQDHEVVFRX-UHFFFAOYSA |
| mp | 159-160 °C (lit.) |
| Quality Level | 100  |
| SMILES string | OC(=O)Cc1ccc(cc1)-c2ccccc |
| solubility | DMSO: soluble 50 mg/mL, clear, colorless to yellow |
| Application: | 4-Biphenylacetic acid was used in the synthesis of gastrosparing non-steroidal antiinflammatory drug. |
| General description: | 4-Biphenylacetic acid is a potential non-steroidal antiinflammatory agent and forms solid inclusion complex with β-cyclodextrin. 4-Biphenylacetic acid on interaction with quinolone antibacterial agents induces functional blockade of the γ-aminobutyric acid receptors. |
| Packaging: | 25 g in poly bottle |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 + H331 - H315 - H319 - H335 |
| Precautionary statements | P301 + P310 + P330 - P302 + P352 - P304 + P340 + P311 - P305 + P351 + P338 |
| Hazard Codes | T |
| Risk Statements | 23/25-36/37/38 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2811 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 159-160 °C (lit.) |
| UNSPSC | 12352100 |