Diethyl bis(hydroxymethyl)malonate
ALDRICH/198358 - 97%
Synonym: Diethyl 2,2-
CAS Number: 20605-01-0
Empirical Formula (Hill Notation): C9H16O6
Molecular Weight: 220.22
EC Number: 243-916-8
MDL Number: MFCD00009130
Linear Formula: (HOCH2)2C(CO2CH2CH3)2
Product Type: Chemical
| assay | 97% |
| InChI | 1S/C9H16O6/c1-3-14-7(12)9 |
| InChI key | WIOHBOKEUIHYIC-UHFFFAOYSA |
| mp | 49-51 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | CCOC(=O)C(CO)(CO)C(=O)OCC |
| Application: | Reagent for preparing 1,3-dioxanes from acetals, aldehydes, and ketones. |
| Packaging: | 25, 100 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 230.0 °F - closed cup |
| Flash Point(C) | 110 °C - closed cup |
| Purity | 97% |
| mp | 49-51 °C (lit.) |
| UNSPSC | 12162002 |

