Janus Green B
ALDRICH/201677 - certified by the BSC, Dye content 65 %
Synonym: 3-
CAS Number: 2869-83-2
Empirical Formula (Hill Notation): C30H31ClN6
Molecular Weight: 511.06
EC Number: 220-695-6
MDL Number: MFCD00011758
Linear Formula: C30H31ClN6
Product Type: Chemical
| ε (extinction coefficient) | ≥28000 at 651-677 nm in ethanol: water (1:1) at 0.01 g/L |
| λmax | 395 nm |
| 660 nm (2nd) | |
| agency | certified by the BSC |
| application(s) | diagnostic assay manufacturing hematology histology |
| color | black |
| very dark brown | |
| very dark green | |
| composition | Dye content, 65% |
| form | powder |
| InChI | 1S/C30H31N6.ClH/c1-5-35(6 |
| InChI key | XXACTDWGHQXLGW-UHFFFAOYSA |
| Quality Level | 200 ![]() |
| SMILES string | [Cl-].CCN(CC)c1ccc2nc3ccc |
| storage temp. | room temp |
| technique(s) | microbe id | staining: suitable |
| Application: | Janus Green B has been used in staining technique to determine cell density, to detect the presence of telocytes in trachea and lungs and used as a dye to visualize bonghan ducts inside lymphatic vessels of rabbits. |
| Biochem/physiol Actions: | Janus Green B belongs to the phenazine group of dyes. It is a dark green/dark brown/dark black powder. Janus Green B should be oxidized to become colored. Thus, this dye can be used to specifically stain mitochondria in living cells. It has been used to stain biomolecules, nucleic acids and chromosomes. In addition, it is also used to stain various living organisms including fungi, yeast cell, brain, spinal cord, sperms and tissue culture monolayer. Janus Green B acts as an antimalarial agent. It also facilitates diagnostic assays and diagnosis of disease related to amyloid accumulation. |
| Packaging: | 5, 25 g in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Storage Temp. | room temp |
| Colour Index Number | 11050; 11050 |
| UNSPSC | 12171500 |

