(−)-Menthone
ALDRICH/218235 - 90%
Synonym: (1R,4S)-p-Menthan-3-one; (2S,5R)
CAS Number: 14073-97-3
Empirical Formula (Hill Notation): C10H18O
Molecular Weight: 154.25
EC Number: 237-926-1
MDL Number: MFCD00001634
Linear Formula: C10H18O
Product Type: Chemical
| assay | 90% |
| bp | 207-210 °C (lit.) |
| density | 0.893 g/mL at 20 °C (lit.) |
| form | liquid |
| functional group | ketone |
| impurities | 5% isomenthone |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8 |
| InChI key | NFLGAXVYCFJBMK-BDAKNGLRSA |
| optical activity | [α]20/D −20°, neat |
| Quality Level | 100  |
| refractive index | n |
| SMILES string | CC(C)[C@@H]1CC[C@@H](C)CC |
| vapor pressure | 0.5 mmHg ( 20 °C) |
| Application: | (-)-Menthone may be used to synthesize chiral neomenthyl derivatives, optically pure α-ferrocenylalkylamines and optically active polyalkylcyclohexanones. |
| General description: | (-)-Menthone is a monoterpenoid compound found in the essential oil extracted from the maturing peppermint (Mentha piperita L.) leaves. (-)-Menthone can undergo hydrogenation to yield a mixture of (-)-menthol and (+)-neomenthol. |
| Packaging: | 25, 100 g in poly bottle |
| Symbol |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H317 |
| Precautionary statements | P280 - P302 + P352 |
| Hazard Codes | Xi |
| Risk Statements | 38-43 |
| Safety Statements | 36/37 |
| WGK Germany | WGK 1 |
| Flash Point(F) | 165.2 °F |
| Flash Point(C) | 74 °C |
| Purity | 90% |
| bp | 207-210 °C (lit.) |
| Density | 0.893 g/mL at 20 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352115 |