(+)-Limonene oxide, mixture of cis and trans
ALDRICH/218324 - 97%
Synonym: (3R)
CAS Number: 203719-54-4
Empirical Formula (Hill Notation): C10H16O
Molecular Weight: 152.23
MDL Number: MFCD00074770
Linear Formula: C10H16O
Product Type: Chemical
| assay | 97% |
| bp | 113-114 °C/50 mmHg (lit.) |
| density | 0.929 g/mL at 25 °C (lit.) |
| form | liquid |
| functional group | ether |
| InChI | 1S/C10H16O/c1-7(2)8-4-5-1 |
| InChI key | CCEFMUBVSUDRLG-XNWIYYODSA |
| optical purity | ee: 98% (GLC) |
| Quality Level | 100 ![]() |
| refractive index | n |
| SMILES string | CC(=C)[C@@H]1CCC2(C)OC2C1 |
| Application: | (+)-Limonene oxide (mixture of cis and trans) undergoes biocatalytic resolution in the presence of epoxide hydrolase to form enantiomerically pure cis- and trans-limonene oxides. |
| General description: | Limonene oxide, also known as limonene 1,2-epoxide, is a monoterpene that can be prepared from limonene. It has antinociceptive and antitumoral activities and is used in many products like food additives, cosmetics, and perfumes. |
| Packaging: | 50 g in glass bottle |
| WGK Germany | WGK 3 |
| Flash Point(F) | 149.0 °F - closed cup |
| Flash Point(C) | 65 °C - closed cup |
| Purity | 97% |
| bp | 113-114 °C/50 mmHg (lit.) |
| Density | 0.929 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| UNSPSC | 12352005 |

