Trioctylphosphine oxide
ALDRICH/223301 - ReagentPlus®, 99%
Synonym: (Oct)3PO; TOPO®
CAS Number: 78-50-2
Empirical Formula (Hill Notation): C24H51OP
Molecular Weight: 386.63
EC Number: 201-121-3
MDL Number: MFCD00002083
Linear Formula: [CH3(CH2)7]3PO
Product Type: Chemical
| assay | 99% |
| bp | 201-202 °C/2 mmHg (lit.) |
| form | solid |
| functional group | phosphine |
| InChI | 1S/C24H51OP/c1-4-7-10-13- |
| InChI key | ZMBHCYHQLYEYDV-UHFFFAOYSA |
| mp | 50-52 °C (lit.) |
| product line | ReagentPlus® |
| Quality Level | 200 ![]() |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| reagent type: ligand | |
| SMILES string | CCCCCCCCP(=O)(CCCCCCCC)CC |
| Application: | Used to extract metals and hydrogen bonding organic compounds. For a review of industrial applications. |
| Legal Information: | ReagentPlus is a registered trademark of Merck KGaA, Darmstadt, Germany |
| Legal Information: | TOPO is a registered trademark of Life Technologies |
| Packaging: | 5, 25, 100, 500 g in glass bottle |
| Symbol | GHS05 |
| Signal word | Danger |
| Hazard statements | H315 - H318 - H412 |
| Precautionary statements | P273 - P280 - P305 + P351 + P338 + P310 |
| Hazard Codes | Xi |
| Risk Statements | 38-41-52/53 |
| Safety Statements | 26-39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | 446.0 °F - closed cup |
| Flash Point(C) | 230 °C - closed cup |
| Purity | 99% |
| bp | 201-202 °C/2 mmHg (lit.) |
| mp | 50-52 °C (lit.) |
| UNSPSC | 12352119 |


