4-(Fluorosulfonyl)benzoic acid
ALDRICH/224189 - 95%
Synonym: 4-
CAS Number: 455-26-5
Empirical Formula (Hill Notation): C7H5FO4S
Molecular Weight: 204.18
EC Number: 207-243-3
MDL Number: MFCD00007420
Linear Formula: FSO2C6H4CO2H
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material.
This image depicts SKU: 224189-5G
This image depicts SKU: 224189-5G
| assay | 95% |
| form | solid |
| functional group | carboxylic acid |
| InChI | 1S/C7H5FO4S/c8-13(11,12)6 |
| InChI key | DJUJJHDCOUPERR-UHFFFAOYSA |
| mp | 272-273 °C (lit.) |
| Quality Level | 100  |
| reaction suitability | reaction type: click chemistry |
| SMILES string | OC(=O)c1ccc(cc1)S(F)(=O)= |
| Application: | 4-(Fluorosulfonyl)benzoic acid was used as an affinity label of dimeric pig lung pi class glutathione S-transferase. |
| General description: | 4-(Fluorosulfonyl)benzoic acid is a a xenobiotic substrate analogue which on incubation with 4-4 isozyme of rat liver glutathione S-transferase results in a time-dependent inactivation of the enzyme. |
| Packaging: | 5 g in glass bottle |
| Symbol |  GHS05 |
| Signal word | Danger |
| Hazard statements | H314 |
| Precautionary statements | P280 - P305 + P351 + P338 - P310 |
| Hazard Codes | C |
| Risk Statements | 34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 3261 8 / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 95% |
| mp | 272-273 °C (lit.) |
| UNSPSC | 12352100 |