Synonym: 3,4-Dihydro-3,4-dioxo-1-naphthalenesulfonic acid sodium salt; Folin’s reagent; Sodium 1,2-naphthoquinone-4-sulfonate
CAS Number: 521-24-4
Empirical Formula (Hill Notation): C10H5NaO5S
Molecular Weight: 260.20
EC Number: 208-308-9
MDL Number: MFCD00001700
Linear Formula: C10H5NaO5S
Product Type: Chemical
| assay |
97% |
| form |
powder |
| InChI |
1S/C10H6O5S.Na/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12;/h1-5H,(H,13,14,15);/q;+1/p-1 |
| InChI key |
UBLXEEBHYISRFM-UHFFFAOYSA-M |
| mp |
289 °C (dec.) (lit.) |
| Quality Level |
100  |
| SMILES string |
[Na+].[O-]S(=O)(=O)C1=CC(=O)C(=O)c2ccccc12 |
| solubility |
acetone: moderately soluble(lit.) |
| |
alcohol: slightly soluble 95% |
| |
benzene: insoluble(lit.) |
| |
carbon disulfide: insoluble(lit.) |
| |
chloroform: insoluble(lit.) |
| |
diethyl ether: insoluble(lit.) |
| |
petroleum ether: insoluble(lit.) |
| |
water: soluble(lit.) |
| Application: |
1,2-Naphthoquinone-4-sulfonic acid sodium salt (Folin′s reagent) was used in the colorimetric assay for determination of procaine hydrochloride in pharmaceutical preparations. |
| Packaging: |
10 g in glass bottle |
| Hazard Codes |
Xi |
| Risk Statements |
36/37/38 |
| Safety Statements |
26 |
| RIDADR |
NONH for all modes of transport |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Purity |
97% |
| mp |
289 °C (dec.) (lit.) |
| UNSPSC |
12352100 |
