2,2,2-Trichloro-1,1-dimethylethyl chloroformate
ALDRICH/226505 - 96%
Synonym: β,β,β-Trichloro-tert-butyl chloroformate; β,β,β-Trichloro-tert-butoxycarbonyl chloride; TCBoc-chloride
CAS Number: 66270-36-8
Empirical Formula (Hill Notation): C5H6Cl4O2
Molecular Weight: 239.91
EC Number: 266-293-4
MDL Number: MFCD00000801
Linear Formula: ClCO2C(CH3)2CCl3
Product Type: Chemical
ATR-IR Spectra for β,β,β-Trichloro-tert-butyl chloroformate.
FT-IR Spectra for TCBoc-chloride.
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 226505-5G
| assay | 96% |
| bp | 83-84 °C/14 mmHg (lit.) |
| form | solid |
| functional group | chloro |
| InChI | 1S/C5H6Cl4O2/c1-4(2,5(7,8 |
| InChI key | GMELMFSDPDSXOZ-UHFFFAOYSA |
| mp | 28-30 °C (lit.) |
| Quality Level | 200  |
| SMILES string | CC(C)(OC(Cl)=O)C(Cl)(Cl)C |
| solubility | ethanol: soluble 10%, clear, colorless |
| storage temp. | 2-8°C |
| General description: | The solvolysis rate constants of 2,2,2-trichloro-1,1-dimet |
| Packaging: | 5, 25 g in glass bottle |
| Symbol |   GHS05,GHS06 |
| Signal word | Danger |
| Hazard statements | H301 + H311 + H331 - H314 |
| Precautionary statements | P260 - P270 - P280 - P303 + P361 + P353 - P304 + P340 + P310 - P305 + P351 + P338 |
| Hazard Codes | T |
| Risk Statements | 23/24/25-34 |
| Safety Statements | 26-36/37/39-45 |
| RIDADR | UN 2928 8(6.1) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 96% |
| bp | 83-84 °C/14 mmHg (lit.) |
| mp | 28-30 °C (lit.) |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352100 |