5-Chloro-2-nitrotoluene
ALDRICH/226653 - 98%
CAS Number: 5367-28-2
Empirical Formula (Hill Notation): C7H6ClNO2
Molecular Weight: 171.58
EC Number: 226-355-3
MDL Number: MFCD00024579
Linear Formula: CH3C6H3(NO2)Cl
Product Type: Chemical
| assay | 98% |
| functional group | chloro |
| nitro | |
| InChI | 1S/C7H6ClNO2/c1-5-4-6(8)2 |
| InChI key | NSMZCUAVEOTJDS-UHFFFAOYSA |
| mp | 27-30 °C (lit.) |
| Quality Level | 100 ![]() |
| SMILES string | Cc1cc(Cl)ccc1[N+]([O-])=O |
| General description: | The cytotoxicity of 5-chloro-2-nitrotoluene, an analog of chlorphenamidine, was studied. |
| Packaging: | 25 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H302 - H319 |
| Precautionary statements | P301 + P312 + P330 - P305 + P351 + P338 |
| Hazard Codes | Xn,N |
| Risk Statements | 22-36-52/53 |
| Safety Statements | 26-36-61 |
| RIDADR | UN 3457 6.1 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 98% |
| mp | 27-30 °C (lit.) |
| UNSPSC | 12352100 |


