Fast Corinth V zinc chloride double salt
ALDRICH/227366 - Dye content ≥90 %
Synonym: Azoic Diazo Component 39; Azoic Diazo No. 39
CAS Number: 61966-14-1
Empirical Formula (Hill Notation): C15H14N5O3 · 0.5Cl4Zn
Molecular Weight: 415.90
EC Number: 263-357-3
MDL Number: MFCD29074182
Linear Formula: C15H14N5O3 · 0.5Cl4Zn
Product Type: Chemical
| ε (extinction coefficient) | ≥10000 at 335-375 nm in ethanol |
| λmax | 356 nm |
| application(s) | diagnostic assay manufacturing hematology histology |
| composition | Dye content, ≥90% |
| form | solid |
| InChI | 1S/2C15H14N5O3.4ClH.Zn/c2 |
| InChI key | VUFIPLOIANLIBR-BKZLANPUSA |
| mp | 147 °C (dec.) (lit.) |
| Quality Level | 200 ![]() |
300 ![]() |
|
| SMILES string | Cl[Zn--](Cl)(Cl)Cl.COc1cc |
| storage temp. | room temp |
| Application: | Fast Corinth V is a visualizing agent that can be used for quantitative TLC detection of zeranol. It is also used to functionalize carbon powder with nitroazobenzene groups by the process of reduction to modify the carbon particle surface. |
| General description: | Fast Corinth V zinc chloride double salt is a benzene diazonium zinc chloride double salt. It is also known as 4-Methyl-6-nitro-4-[(3-me |
| Packaging: | 5, 25 g in glass bottle |
| Symbol | ![]() GHS07,GHS08 |
| Signal word | Danger |
| Hazard statements | H302 + H312 + H332 - H350 |
| Precautionary statements | P201 - P280 - P301 + P312 + P330 - P302 + P352 + P312 - P304 + P340 + P312 - P308 + P313 |
| Hazard Codes | T |
| Risk Statements | 45-46-20/21/22 |
| Safety Statements | 53-22-36/37/39-45 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| mp | 147 °C (dec.) (lit.) |
| Storage Temp. | room temp |
| Colour Index Number | 37220 |
| UNSPSC | 12171500 |



