Diphenylphosphinic chloride
ALDRICH/230235 - 98%
Synonym: Diphenylchlorophosphine oxide; Diphenylphosphinic acid chloride; Diphenylphosphinoyl chloride; Diphenylphosphinyl chloride; Diphenylphosphorus oxychloride; Ph2POCl; Chlorodiphenylphosphine oxide
CAS Number: 1499-21-4
Empirical Formula (Hill Notation): C12H10ClOP
Molecular Weight: 236.63
EC Number: 216-107-2
MDL Number: MFCD00002077
Linear Formula: (C6H5)2P(O)Cl
Product Type: Chemical
| assay | 98% |
| bp | 222 °C/16 mmHg (lit.) |
| density | 1.24 g/mL at 25 °C (lit.) |
| form | liquid |
| InChI | 1S/C12H10ClOP/c13-15(14,1 |
| InChI key | QPQGTZMAQRXCJW-UHFFFAOYSA |
| Quality Level | 100  |
| reaction suitability | reaction type: Buchwald-Hartwig Cross Coupling Reaction |
| reaction type: Heck Reaction | |
| reaction type: Hiyama Coupling | |
| reaction type: Negishi Coupling | |
| reaction type: Sonogashira Coupling | |
| reaction type: Stille Coupling | |
| reaction type: Suzuki-Miyaura Coupling | |
| refractive index | n |
| SMILES string | ClP(=O)(c1ccccc1)c2ccccc2 |
| storage temp. | 2-8°C |
| Application: | Diphenylphosphinic chloride (Ph2POCl) is widely used as a precursor to synthesize various chiral phosphine bidentate ligands for asymmetric synthesis, in addition to several peptide coupling agents. |
| Packaging: | 10, 50 g in glass bottle |
| Symbol |   GHS02,GHS05 |
| Signal word | Danger |
| Hazard statements | H226 - H314 |
| Precautionary statements | P210 - P280 - P303 + P361 + P353 - P305 + P351 + P338 + P310 |
| Hazard Codes | C |
| Risk Statements | 10-34 |
| Safety Statements | 16-26-36/37/39-45 |
| RIDADR | UN 2920 3(8) / PGII |
| WGK Germany | WGK 3 |
| Flash Point(F) | 78.8 °F - closed cup |
| Flash Point(C) | 26 °C - closed cup |
| Purity | 98% |
| bp | 222 °C/16 mmHg (lit.) |
| Density | 1.24 g/mL at 25 °C (lit.) |
| Refractive Index | n |
| Storage Temp. | 2-8°C |
| UNSPSC | 12352002 |