Synonym: 1,3,5,2,4,6-Triazatriphosphorine-2,2,4,4,6,6-hexachloride; 1,3,5-Triaza-2,4,6-triphosphorin-2,2,4,4,6,6-hexachloride; Hexachlorocyclotriphosphazene
CAS Number: 940-71-6
Empirical Formula (Hill Notation): Cl6N3P3
Molecular Weight: 347.66
EC Number: 213-376-8
MDL Number: MFCD00006474
Linear Formula: (NPCl2)3
Product Type: Chemical
| assay |
99% |
| density |
1.98 g/mL at 25 °C (lit.) |
| form |
solid |
| InChI |
1S/Cl6N3P3/c1-10(2)7-11(3,4)9-12(5,6)8-10 |
| InChI key |
UBIJTWDKTYCPMQ-UHFFFAOYSA-N |
| mp |
112-115 °C (lit.) |
| Quality Level |
200  |
| SMILES string |
Clp1(Cl)np(Cl)(Cl)np(Cl)(Cl)n1 |
| Application: |
Reagent for the synthesis of ″dandelion″ (spherical) dendrimers. Ring-opening polymerization, ligand and/or ligand precursor for transition metals, and the study of P-Cl bond substitution reactions are among the interesting uses for this product. |
| Packaging: |
25, 100 g in glass bottle |
| Symbol |
 GHS05 |
| Signal word |
Danger |
| Hazard statements |
H314 |
| Precautionary statements |
P280 - P305 + P351 + P338 - P310 |
| Hazard Codes |
C |
| Risk Statements |
14-34 |
| Safety Statements |
26-36/37/39-45 |
| RIDADR |
UN 3260 8 / PGII |
| WGK Germany |
WGK 3 |
| Flash Point(F) |
Not applicable |
| Flash Point(C) |
Not applicable |
| Supplemental Hazard Statements |
EUH014 |
| Purity |
99% |
| mp |
112-115 °C (lit.) |
| Density |
1.98 g/mL at 25 °C (lit.) |
| UNSPSC |
12162002 |
