Benzyl cinnamate
ALDRICH/234214 - 99%
Synonym: 3-Phenyl 2-propenoic acid benzyl ester; Benzyl 3-phenylpropenoate; Cinnamic acid benzyl ester
CAS Number: 103-41-3
Empirical Formula (Hill Notation): C16H14O2
Molecular Weight: 238.28
EC Number: 203-109-3
MDL Number: MFCD00004789
Linear Formula: C6H5CH=CHCOOCH2C6H5
Product Type: Chemical
This picture is provided solely for illustration purposes. Optical properties of the actual product may deviate. Relevant product information is printed on labeled products and other accompanying or available information material. This image depicts SKU: 234214-100G.
| assay | 99% |
| bp | 195-200 °C/5 mmHg (lit.) |
| form | solid |
| InChI | 1S/C16H14O2/c17-16(12-11- |
| InChI key | NGHOLYJTSCBCGC-VAWYXSNFSA |
| mp | 34-37 °C (lit.) |
| Quality Level | 100  |
| SMILES string | O=C(OCC1=CC=CC=C1)/C=C/C2 |
| solubility | alcohol: soluble(lit.) |
| diethyl ether: soluble(lit.) | |
| glycerol: insoluble (practically)(lit.) | |
| oil: soluble(lit.) | |
| propylene glycol: insoluble (practically)(lit.) | |
| water: insoluble (practically)(lit.) |
| Application: | Benzyl cinnamate has been employed as internal standard during the determination of compounds commonly added to personal care products such as UV filters and antimicrobial agents in environmental samples. |
| General description: | Benzyl cinnamate is widely used as a fragrance ingredient. |
| Packaging: | 100 g in glass bottle |
| Symbol |   GHS07,GHS09 |
| Signal word | Warning |
| Hazard statements | H317 - H410 |
| Precautionary statements | P261 - P272 - P273 - P280 - P302 + P352 - P333 + P313 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 2 |
| Flash Point(F) | 356.0 °F |
| Flash Point(C) | 180 °C |
| Purity | 99% |
| bp | 195-200 °C/5 mmHg (lit.) |
| mp | 34-37 °C (lit.) |
| UNSPSC | 12352100 |