Synonym: (−)-1,4-Bis(diphenylphosphino)-1,4-dideoxy-2,3-O-isopropylidene-L-threitol; (4R,5R)-4,5-Bis(diphenylphosphino-methyl)-2,2-dimethyl-1,3-dioxolane; (4R-trans)-[(2,2-Dimethyl-1,3-dioxolane-4,5-diyl)bis(methylene)]bis(diphenylphosphine); (R,R)-DIOP
CAS Number: 32305-98-9
Empirical Formula (Hill Notation): C31H32O2P2
Molecular Weight: 498.53
EC Number: 250-984-2
MDL Number: MFCD00014107
Linear Formula: C31H32O2P2
Product Type: Chemical
| assay |
98% |
| InChI |
1S/C31H32O2P2/c1-31(2)32-29(23-34(25-15-7-3-8-16-25)26-17-9-4-10-18-26)30(33-31)24-35(27-19-11-5-12-20-27)28-21-13-6-14-22-28/h3-22,29-30H,23-24H2,1-2H3/t29-,30-/m0/s1 |
| InChI key |
VCHDBLPQYJAQSQ-KYJUHHDHSA-N |
| mp |
88-90 °C (lit.) |
| optical activity |
[α]19/D −26°, c = 2.3 in chloroform |
| Quality Level |
100  |
| SMILES string |
CC1(C)O[C@@H](CP(c2ccccc2)c3ccccc3)[C@H](CP(c4ccccc4)c5ccccc5)O1 |
| storage temp. |
2-8°C |
| Application: |
For the in situ preparation of chiral hydrogenation catalysts. |
| General description: |
(-)-2,3-O-Isopropylidene-2,3-dihydroxy-1,4-bis(diphenylphosphino)butane is a C2 chelating diphosphine ligand for transition metal complexes during asymmetric catalysis. |
| Packaging: |
1 g in glass bottle |
| Purity |
98% |
| mp |
88-90 °C (lit.) |
| Storage Temp. |
2-8°C |
| UNSPSC |
12352005 |