Triphenyl phosphate
ALDRICH/241288 - ≥99%
Synonym: Triphenoxyphosphine oxide
CAS Number: 115-86-6
Empirical Formula (Hill Notation): C18H15O4P
Molecular Weight: 326.28
EC Number: 204-112-2
MDL Number: MFCD00003031
Linear Formula: (C6H5O)3PO
Product Type: Chemical
| assay | ≥99% |
| bp | 244 °C/10 mmHg (lit.) |
| functional group | phosphate |
| InChI | 1S/C18H15O4P/c19-23(20-16 |
| InChI key | XZZNDPSIHUTMOC-UHFFFAOYSA |
| mp | 48-50 °C (lit.) |
| Quality Level | 200  |
| SMILES string | O=P(Oc1ccccc1)(Oc2ccccc2) |
| solubility | acetone: soluble(lit.) |
| alcohol: moderately soluble(lit.) | |
| benzene: soluble(lit.) | |
| chloroform: soluble(lit.) | |
| diethyl ether: soluble(lit.) | |
| water: insoluble(lit.) | |
| vapor pressure | 1.3 mmHg ( 200 °C) |
| Application: | Triphenyl phosphate was used as an internal standard in the screening and quantification of pesticide residues in vegetables and fruits. |
| General description: | Triphenyl phosphate, an organophosphorus flame retardant (PFR), was determined in human milk sample. |
| Packaging: | 50 g in glass bottle |
| Hazard Codes | N |
| Risk Statements | 50/53 |
| Safety Statements | 60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | > 446.0 °F |
| Flash Point(C) | > 230 °C |
| Purity | ≥99% |
| bp | 244 °C/10 mmHg (lit.) |
| mp | 48-50 °C (lit.) |
| UNSPSC | 12352100 |