Lead(II) carbonate basic
ALDRICH/243582 - −325 mesh
Synonym: Lead(2+) dicarbonate dihydroxide; Trilead bis(carbonate) dihydroxide
CAS Number: 1319-46-6
Empirical Formula (Hill Notation): C2H2O8Pb3
Molecular Weight: 775.63
EC Number: 215-290-6
MDL Number: MFCD00078155
Linear Formula: (PbCO3)2·Pb(OH)2
Product Type: Chemical
| assay | 78.0-82.0% Pb basis (EDTA titration) |
| form | powder |
| InChI | 1S/2CH2O3.2H2O.3Pb/c2*2-1 |
| InChI key | RYZCLUQMCYZBJQ-UHFFFAOYSA |
| mp | 400 °C (dec.) (lit.) |
| particle size | −325 mesh |
| Quality Level | 100 ![]() |
| reaction suitability | core: lead |
| SMILES string | [PbH2++].[PbH2++].O[PbH2] |
| Application: | Lead(II) carbonate basic can be used: • As a precursor to synthesize formamidinium lead iodide perovskite nanocrystals, for optoelectronic devices. • To fabricate Pb3(OH)2(CO3)2/C anode materials for lithium-ion batteries. |
| General description: | Lead(II) carbonate basic is also known as whitelead. It is insoluble in waterand ethanol. It is widely used as a white pigment for paintingapplications. |
| Packaging: | 100 g in poly bottle |
| Packaging: | 2.5 kg in poly bottle |
| Symbol | ![]() ![]() GHS07,GHS08,GHS09 |
| Signal word | Danger |
| Hazard statements | H302 + H332 - H360Df - H373 - H410 |
| Precautionary statements | P201 - P273 - P301 + P312 + P330 - P304 + P340 + P312 - P308 + P313 |
| Hazard Codes | T,N |
| Risk Statements | 61-20/22-33-50/53-62 |
| Safety Statements | 53-45-60-61 |
| RIDADR | UN 3077 9 / PGIII |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 78.0-82.0% Pb basis (EDTA titration) |
| mp | 400 °C (dec.) (lit.) |
| UNSPSC | 12352302 |




