9-Acridinecarboxylic acid hydrate
ALDRICH/246344 - 97%
CAS Number: 332927-03-4
Empirical Formula (Hill Notation): C14H9NO2 · xH2O
Molecular Weight: 223.23 (anhydrous basis)
MDL Number: MFCD00149578
Linear Formula: C14H9NO2 · xH2O
Product Type: Chemical
| assay | 97% |
| form | powder |
| functional group | carboxylic acid |
| InChI | 1S/C14H9NO2.H2O/c16-14(17 |
| InChI key | ZQAZWHSZYVXGMP-UHFFFAOYSA |
| mp | 290 °C (dec.) (lit.) |
| Quality Level | 200 ![]() |
| SMILES string | [H]O[H].OC(=O)c1c2ccccc2n |
| Application: | 9-Acridinecarboxylic acid hydrate has been used to synthesize a DNA intercalator in order to capture double-stranded DNAs (dsDNAs) duplex from the solution. |
| Packaging: | 1, 5 g in glass bottle |
| Symbol | GHS07 |
| Signal word | Warning |
| Hazard statements | H315 - H319 - H335 |
| Precautionary statements | P302 + P352 - P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 97% |
| mp | 290 °C (dec.) (lit.) |
| UNSPSC | 12352100 |


