Bicyclo[2.2.1]hepta-2,5-diene-rhodium(I) chloride dimer
ALDRICH/249939 - 96%
Synonym: [Rh(nbd)Cl]2; dichlorobis(norbornadiene)
CAS Number: 12257-42-0
Empirical Formula (Hill Notation): C14H16Cl2Rh2
Molecular Weight: 460.99
EC Number: 235-510-4
MDL Number: MFCD00198060
Linear Formula: C14H16Cl2Rh2
Product Type: Chemical
| assay | 96% |
| form | powder |
| InChI | 1S/2C7H8.2ClH.2Rh/c2*1-2- |
| InChI key | RXDWVIOULPVOEO-SEGRDSFWSA |
| Quality Level | 100 ![]() |
| reaction suitability | core: rhodium |
| reagent type: catalyst | |
| SMILES string | Cl[Rh].Cl[Rh].[CH]1[CH]C2 |
| Application: | Umicore Precatalysts for Asymmetric and Cross-Coupling Catalysis ![]() Hydrosilylation Catalysts ![]() |
| Packaging: | 500 mg in glass bottle |
| RIDADR | NONH for all modes of transport |
| WGK Germany | WGK 3 |
| Flash Point(F) | Not applicable |
| Flash Point(C) | Not applicable |
| Purity | 96% |
| UNSPSC | 12161600 |

